C20H21NO2 — CID 2710172
(E)-3-(3-methoxyphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide (PubChem CID 2710172) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (E)-3-(3-methoxyphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxyphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2710172 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (E)-3-(3-methoxyphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)N[C@H]2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C20H21NO2/c1-23-17-9-4-6-15(14-17)12-13-20(22)21-19-11-5-8-16-7-2-3-10-18(16)19/h2-4,6-7,9-10,12-14,19H,5,8,11H2,1H3,(H,21,22)/b13-12+/t19-/m0/s1 |
| InChIKey | GKIJFGJJUKVGIJ-HYSAVQALSA-N |
| XLogP | 3.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|