C13H15NO2 — CID 78488507
N-cyclopropyl-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 78488507) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is N-cyclopropyl-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-cyclopropyl-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78488507 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-cyclopropyl-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)NC2CC2)c1 |
| InChI | InChI=1S/C13H15NO2/c1-16-12-4-2-3-10(9-12)5-8-13(15)14-11-6-7-11/h2-5,8-9,11H,6-7H2,1H3,(H,14,15) |
| InChIKey | VDMCCKULTIESEX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|