C21H20FNO3 — CID 2552388
[2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 2552388) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2552388 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(F)cc1)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C21H20FNO3/c22-17-11-8-15(9-12-17)10-13-21(25)26-14-20(24)23-19-7-3-5-16-4-1-2-6-18(16)19/h1-2,4,6,8-13,19H,3,5,7,14H2,(H,23,24)/b13-10+/t19-/m0/s1 |
| InChIKey | DQWVOLAESCCYAE-QHSLDKKCSA-N |
| XLogP | 3.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|