C20H18N2OS — CID 7919680
(E)-3-(1,3-benzothiazol-2-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide (PubChem CID 7919680) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7919680 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H18N2OS/c23-19(12-13-20-22-17-9-3-4-11-18(17)24-20)21-16-10-5-7-14-6-1-2-8-15(14)16/h1-4,6,8-9,11-13,16H,5,7,10H2,(H,21,23)/b13-12+/t16-/m0/s1 |
| InChIKey | ZPYOVINNNZKAPL-DBTPVHCXSA-N |
| XLogP | 4.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|