C17H20N2O2S — CID 95775249
(E)-3-(1,3-benzothiazol-2-yl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide (PubChem CID 95775249) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 95775249 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)NC[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C17H20N2O2S/c20-14-7-3-1-5-12(14)11-18-16(21)9-10-17-19-13-6-2-4-8-15(13)22-17/h2,4,6,8-10,12,14,20H,1,3,5,7,11H2,(H,18,21)/b10-9+/t12-,14-/m0/s1 |
| InChIKey | ARXXBXSQVZTTFT-OKWZRIHXSA-N |
| XLogP | 2.98 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|