C18H14F2N2OS — CID 55807586
(E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-difluorophenyl)ethyl]prop-2-enamide (PubChem CID 55807586) has the molecular formula C18H14F2N2OS and a molecular weight of 344.39 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-difluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-difluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55807586 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-difluorophenyl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C18H14F2N2OS/c19-13-4-3-5-14(20)12(13)10-11-21-17(23)8-9-18-22-15-6-1-2-7-16(15)24-18/h1-9H,10-11H2,(H,21,23)/b9-8+ |
| InChIKey | YVHJHVHMMNZKNJ-CMDGGOBGSA-N |
| XLogP | 3.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|