C14H13N5OS2 — CID 171139541
3-(1,3-benzothiazol-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]prop-2-enamide (PubChem CID 171139541) has the molecular formula C14H13N5OS2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171139541 |
| Molecular Formula | C14H13N5OS2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1nc2ccccc2s1)NCCSc1cn[nH]n1 |
| InChI | InChI=1S/C14H13N5OS2/c20-12(15-7-8-21-14-9-16-19-18-14)5-6-13-17-10-3-1-2-4-11(10)22-13/h1-6,9H,7-8H2,(H,15,20)(H,16,18,19) |
| InChIKey | ZPRJHUDXPQKGJX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|