C13H12N4OS2 — CID 56745283
N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 56745283) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 56745283 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCSc1cn[nH]n1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H12N4OS2/c18-13(14-5-6-19-12-8-15-17-16-12)11-7-9-3-1-2-4-10(9)20-11/h1-4,7-8H,5-6H2,(H,14,18)(H,15,16,17) |
| InChIKey | BPEYLFRLUTXYSU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|