C16H14N6OS2 — CID 56718990
6-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]imidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 56718990) has the molecular formula C16H14N6OS2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 6-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]imidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 6-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]imidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 56718990 |
| Molecular Formula | C16H14N6OS2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 6-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]imidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | O=C(NCCSc1cn[nH]n1)c1csc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C16H14N6OS2/c23-15(17-6-7-24-14-8-18-21-20-14)13-10-25-16-19-12(9-22(13)16)11-4-2-1-3-5-11/h1-5,8-10H,6-7H2,(H,17,23)(H,18,20,21) |
| InChIKey | LGRFLJPJXLEEEX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|