C14H13N5O2S — CID 70743832
5-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 70743832) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is 5-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 70743832 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCSc1cn[nH]n1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C14H13N5O2S/c20-14(15-6-7-22-13-9-16-19-17-13)11-8-12(21-18-11)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,15,20)(H,16,17,19) |
| InChIKey | LHZGVABBZNBSRP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|