C19H18N4O3 — CID 118877101
5-phenyl-N-[3-(pyridine-3-carbonylamino)propyl]-1,2-oxazole-3-carboxamide (PubChem CID 118877101) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-phenyl-N-[3-(pyridine-3-carbonylamino)propyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-[3-(pyridine-3-carbonylamino)propyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118877101 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-phenyl-N-[3-(pyridine-3-carbonylamino)propyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cc(-c2ccccc2)on1)c1cccnc1 |
| InChI | InChI=1S/C19H18N4O3/c24-18(15-8-4-9-20-13-15)21-10-5-11-22-19(25)16-12-17(26-23-16)14-6-2-1-3-7-14/h1-4,6-9,12-13H,5,10-11H2,(H,21,24)(H,22,25) |
| InChIKey | FBNXNBJGECCWOQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|