C29H30N2OP+ — CID 169012759
triphenyl-[5-(pyridine-3-carbonylamino)pentyl]phosphanium (PubChem CID 169012759) has the molecular formula C29H30N2OP+ and a molecular weight of 453.55 g/mol. Its IUPAC name is triphenyl-[5-(pyridine-3-carbonylamino)pentyl]phosphanium.
| Compound Name | triphenyl-[5-(pyridine-3-carbonylamino)pentyl]phosphanium |
|---|---|
| PubChem CID | 169012759 |
| Molecular Formula | C29H30N2OP+ |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | triphenyl-[5-(pyridine-3-carbonylamino)pentyl]phosphanium |
| SMILES | O=C(NCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C29H29N2OP/c32-29(25-14-13-21-30-24-25)31-22-11-4-12-23-33(26-15-5-1-6-16-26,27-17-7-2-8-18-27)28-19-9-3-10-20-28/h1-3,5-10,13-21,24H,4,11-12,22-23H2/p+1 |
| InChIKey | VPOWAUMORDGPGF-UHFFFAOYSA-O |
| XLogP | 4.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|