C10H11N2O3- — CID 4586549
4-(pyridine-3-carbonylamino)butanoate (PubChem CID 4586549) has the molecular formula C10H11N2O3- and a molecular weight of 207.21 g/mol. Its IUPAC name is 4-(pyridine-3-carbonylamino)butanoate.
| Compound Name | 4-(pyridine-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 4586549 |
| Molecular Formula | C10H11N2O3- |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4-(pyridine-3-carbonylamino)butanoate |
| SMILES | O=C([O-])CCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C10H12N2O3/c13-9(14)4-2-6-12-10(15)8-3-1-5-11-7-8/h1,3,5,7H,2,4,6H2,(H,12,15)(H,13,14)/p-1 |
| InChIKey | NAJVRARAUNYNDX-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|