C11H14N2O2S2 — CID 123417051
S-(sulfanylmethyl) 4-(pyridine-3-carbonylamino)butanethioate (PubChem CID 123417051) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is S-(sulfanylmethyl) 4-(pyridine-3-carbonylamino)butanethioate.
| Compound Name | S-(sulfanylmethyl) 4-(pyridine-3-carbonylamino)butanethioate |
|---|---|
| PubChem CID | 123417051 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | S-(sulfanylmethyl) 4-(pyridine-3-carbonylamino)butanethioate |
| SMILES | O=C(CCCNC(=O)c1cccnc1)SCS |
| InChI | InChI=1S/C11H14N2O2S2/c14-10(17-8-16)4-2-6-13-11(15)9-3-1-5-12-7-9/h1,3,5,7,16H,2,4,6,8H2,(H,13,15) |
| InChIKey | SUYJQICHLRMFPF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|