C21H16Cl6N2O2S3 — CID 88649285
N-(3-sulfanylpropyl)pyridine-3-carboxamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene (PubChem CID 88649285) has the molecular formula C21H16Cl6N2O2S3 and a molecular weight of 637.29 g/mol. Its IUPAC name is N-(3-sulfanylpropyl)pyridine-3-carboxamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene.
| Compound Name | N-(3-sulfanylpropyl)pyridine-3-carboxamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene |
|---|---|
| PubChem CID | 88649285 |
| Molecular Formula | C21H16Cl6N2O2S3 |
| Molecular Weight | 637.29 g/mol |
| Exact Mass | 633.85 |
| IUPAC Name | N-(3-sulfanylpropyl)pyridine-3-carboxamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene |
| SMILES | Clc1cc(Cl)c(SOSc2c(Cl)cc(Cl)cc2Cl)c(Cl)c1.O=C(NCCCS)c1cccnc1 |
| InChI | InChI=1S/C12H4Cl6OS2.C9H12N2OS/c13-5-1-7(15)11(8(16)2-5)20-19-21-12-9(17)3-6(14)4-10(12)18;12-9(11-5-2-6-13)8-3-1-4-10-7-8/h1-4H;1,3-4,7,13H,2,5-6H2,(H,11,12) |
| InChIKey | KIRIYHOTSCTGRU-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.29 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|