C22H16Cl6N2OS4 — CID 88603892
2-pyridin-3-yl-N-(2-sulfanylethyl)prop-2-enethioamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene (PubChem CID 88603892) has the molecular formula C22H16Cl6N2OS4 and a molecular weight of 665.37 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-(2-sulfanylethyl)prop-2-enethioamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene.
| Compound Name | 2-pyridin-3-yl-N-(2-sulfanylethyl)prop-2-enethioamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene |
|---|---|
| PubChem CID | 88603892 |
| Molecular Formula | C22H16Cl6N2OS4 |
| Molecular Weight | 665.37 g/mol |
| Exact Mass | 661.83 |
| IUPAC Name | 2-pyridin-3-yl-N-(2-sulfanylethyl)prop-2-enethioamide;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanyloxysulfanylbenzene |
| SMILES | C=C(C(=S)NCCS)c1cccnc1.Clc1cc(Cl)c(SOSc2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H4Cl6OS2.C10H12N2S2/c13-5-1-7(15)11(8(16)2-5)20-19-21-12-9(17)3-6(14)4-10(12)18;1-8(10(14)12-5-6-13)9-3-2-4-11-7-9/h1-4H;2-4,7,13H,1,5-6H2,(H,12,14) |
| InChIKey | XUMKEHIEWZWNKI-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.37 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|