C18H24N2O2S — CID 88648286
4-tert-butylphenol;N-(2-sulfanylethyl)pyridine-3-carboxamide (PubChem CID 88648286) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 4-tert-butylphenol;N-(2-sulfanylethyl)pyridine-3-carboxamide.
| Compound Name | 4-tert-butylphenol;N-(2-sulfanylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88648286 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 4-tert-butylphenol;N-(2-sulfanylethyl)pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(O)cc1.O=C(NCCS)c1cccnc1 |
| InChI | InChI=1S/C10H14O.C8H10N2OS/c1-10(2,3)8-4-6-9(11)7-5-8;11-8(10-4-5-12)7-2-1-3-9-6-7/h4-7,11H,1-3H3;1-3,6,12H,4-5H2,(H,10,11) |
| InChIKey | BCVHSIXICBJXJZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|