C23H23N3O2 — CID 31974220
N-[2-[(4-tert-butylbenzoyl)amino]phenyl]pyridine-3-carboxamide (PubChem CID 31974220) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[2-[(4-tert-butylbenzoyl)amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(4-tert-butylbenzoyl)amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 31974220 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[2-[(4-tert-butylbenzoyl)amino]phenyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccccc2NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C23H23N3O2/c1-23(2,3)18-12-10-16(11-13-18)21(27)25-19-8-4-5-9-20(19)26-22(28)17-7-6-14-24-15-17/h4-15H,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | IXMYBLCLCPPWIA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |