C20H23N3O2 — CID 108925434
N-[2-[[(E)-3,4,4-trimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide (PubChem CID 108925434) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[2-[[(E)-3,4,4-trimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(E)-3,4,4-trimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925434 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[2-[[(E)-3,4,4-trimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide |
| SMILES | C/C(=C\C(=O)Nc1ccccc1NC(=O)c1cccnc1)C(C)(C)C |
| InChI | InChI=1S/C20H23N3O2/c1-14(20(2,3)4)12-18(24)22-16-9-5-6-10-17(16)23-19(25)15-8-7-11-21-13-15/h5-13H,1-4H3,(H,22,24)(H,23,25)/b14-12+ |
| InChIKey | HPGWOVICGXAWSB-WYMLVPIESA-N |
| XLogP | 4.26 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|