C19H21N3O2 — CID 108925424
N-[2-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide (PubChem CID 108925424) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925424 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[2-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)/C=C/C(=O)Nc1ccccc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C19H21N3O2/c1-19(2,3)11-10-17(23)21-15-8-4-5-9-16(15)22-18(24)14-7-6-12-20-13-14/h4-13H,1-3H3,(H,21,23)(H,22,24)/b11-10+ |
| InChIKey | WZYHIHCLHIJDCF-ZHACJKMWSA-N |
| XLogP | 3.87 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|