C21H18N4O3 — CID 108925269
N-[2-[(2-benzamidoacetyl)amino]phenyl]pyridine-3-carboxamide (PubChem CID 108925269) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[2-[(2-benzamidoacetyl)amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(2-benzamidoacetyl)amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925269 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[2-[(2-benzamidoacetyl)amino]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(CNC(=O)c1ccccc1)Nc1ccccc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C21H18N4O3/c26-19(14-23-20(27)15-7-2-1-3-8-15)24-17-10-4-5-11-18(17)25-21(28)16-9-6-12-22-13-16/h1-13H,14H2,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | NULNXKAQNLAALF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |