C8H10N4O2 — CID 39070404
N-(2-hydrazinyl-2-oxoethyl)pyridine-3-carboxamide (PubChem CID 39070404) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39070404 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)pyridine-3-carboxamide |
| SMILES | NNC(=O)CNC(=O)c1cccnc1 |
| InChI | InChI=1S/C8H10N4O2/c9-12-7(13)5-11-8(14)6-2-1-3-10-4-6/h1-4H,5,9H2,(H,11,14)(H,12,13) |
| InChIKey | XCPLBTYUTXYLDC-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|