C21H24ClN5O8 — CID 160621974
ethyl 2-chloro-2-oxoacetate;ethyl 2-oxo-3-(pyridine-3-carbonylamino)propanoate;pyridine-3-carbohydrazide (PubChem CID 160621974) has the molecular formula C21H24ClN5O8 and a molecular weight of 509.90 g/mol. Its IUPAC name is ethyl 2-chloro-2-oxoacetate;ethyl 2-oxo-3-(pyridine-3-carbonylamino)propanoate;pyridine-3-carbohydrazide.
| Compound Name | ethyl 2-chloro-2-oxoacetate;ethyl 2-oxo-3-(pyridine-3-carbonylamino)propanoate;pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 160621974 |
| Molecular Formula | C21H24ClN5O8 |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | ethyl 2-chloro-2-oxoacetate;ethyl 2-oxo-3-(pyridine-3-carbonylamino)propanoate;pyridine-3-carbohydrazide |
| SMILES | CCOC(=O)C(=O)CNC(=O)c1cccnc1.CCOC(=O)C(=O)Cl.NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C11H12N2O4.C6H7N3O.C4H5ClO3/c1-2-17-11(16)9(14)7-13-10(15)8-4-3-5-12-6-8;7-9-6(10)5-2-1-3-8-4-5;1-2-8-4(7)3(5)6/h3-6H,2,7H2,1H3,(H,13,15);1-4H,7H2,(H,9,10);2H2,1H3 |
| InChIKey | RGUXZLDIGSCFDU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|