C10H7F6N3O4 — CID 161305630
pyridine-3-carbohydrazide;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 161305630) has the molecular formula C10H7F6N3O4 and a molecular weight of 347.17 g/mol. Its IUPAC name is pyridine-3-carbohydrazide;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | pyridine-3-carbohydrazide;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 161305630 |
| Molecular Formula | C10H7F6N3O4 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | pyridine-3-carbohydrazide;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | NNC(=O)c1cccnc1.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7N3O.C4F6O3/c7-9-6(10)5-2-1-3-8-4-5;5-3(6,7)1(11)13-2(12)4(8,9)10/h1-4H,7H2,(H,9,10); |
| InChIKey | VIFARIWGYBRJJR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|