C9H7ClF3NO2 — CID 163330137
4,4,4-trifluoro-1-pyridin-3-ylbutane-1,3-dione;hydrochloride (PubChem CID 163330137) has the molecular formula C9H7ClF3NO2 and a molecular weight of 253.61 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-pyridin-3-ylbutane-1,3-dione;hydrochloride.
| Compound Name | 4,4,4-trifluoro-1-pyridin-3-ylbutane-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 163330137 |
| Molecular Formula | C9H7ClF3NO2 |
| Molecular Weight | 253.61 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 4,4,4-trifluoro-1-pyridin-3-ylbutane-1,3-dione;hydrochloride |
| SMILES | Cl.O=C(CC(=O)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C9H6F3NO2.ClH/c10-9(11,12)8(15)4-7(14)6-2-1-3-13-5-6;/h1-3,5H,4H2;1H |
| InChIKey | GVWWWDUBNSZJDN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|