C22H17NO2 — CID 4267792
1,3-diphenyl-5-pyridin-3-ylpent-2-ene-1,5-dione (PubChem CID 4267792) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1,3-diphenyl-5-pyridin-3-ylpent-2-ene-1,5-dione.
| Compound Name | 1,3-diphenyl-5-pyridin-3-ylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 4267792 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1,3-diphenyl-5-pyridin-3-ylpent-2-ene-1,5-dione |
| SMILES | O=C(C=C(CC(=O)c1cccnc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17NO2/c24-21(18-10-5-2-6-11-18)14-20(17-8-3-1-4-9-17)15-22(25)19-12-7-13-23-16-19/h1-14,16H,15H2 |
| InChIKey | FQXYAKCDPIWMIV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|