C23H17FO2 — CID 2801867
1-(4-fluorophenyl)-3,5-diphenylpent-2-ene-1,5-dione (PubChem CID 2801867) has the molecular formula C23H17FO2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-diphenylpent-2-ene-1,5-dione.
| Compound Name | 1-(4-fluorophenyl)-3,5-diphenylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 2801867 |
| Molecular Formula | C23H17FO2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-diphenylpent-2-ene-1,5-dione |
| SMILES | O=C(C=C(CC(=O)c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FO2/c24-21-13-11-19(12-14-21)23(26)16-20(17-7-3-1-4-8-17)15-22(25)18-9-5-2-6-10-18/h1-14,16H,15H2 |
| InChIKey | FZZCMODMGKYQGD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|