C23H19NO2 — CID 134868095
(E,5Z)-5-hydroxyimino-1,3,5-triphenylpent-2-en-1-one (PubChem CID 134868095) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is (E,5Z)-5-hydroxyimino-1,3,5-triphenylpent-2-en-1-one.
| Compound Name | (E,5Z)-5-hydroxyimino-1,3,5-triphenylpent-2-en-1-one |
|---|---|
| PubChem CID | 134868095 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (E,5Z)-5-hydroxyimino-1,3,5-triphenylpent-2-en-1-one |
| SMILES | O=C(/C=C(\C/C(=N/O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19NO2/c25-23(20-14-8-3-9-15-20)17-21(18-10-4-1-5-11-18)16-22(24-26)19-12-6-2-7-13-19/h1-15,17,26H,16H2/b21-17+,24-22- |
| InChIKey | ZUGYWDCMQOWBFQ-LQINFFAQSA-N |
| XLogP | 5.22 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|