C25H23NO2 — CID 177497438
(E)-3-[4-(dimethylamino)phenyl]-1,5-diphenylpent-2-ene-1,5-dione (PubChem CID 177497438) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-1,5-diphenylpent-2-ene-1,5-dione.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-1,5-diphenylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 177497438 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-1,5-diphenylpent-2-ene-1,5-dione |
| SMILES | CN(C)c1ccc(/C(=C/C(=O)c2ccccc2)CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23NO2/c1-26(2)23-15-13-19(14-16-23)22(17-24(27)20-9-5-3-6-10-20)18-25(28)21-11-7-4-8-12-21/h3-17H,18H2,1-2H3/b22-17+ |
| InChIKey | DCNYSJGSAFYITO-OQKWZONESA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|