C15H17NO3 — CID 13295314
3-acetyl-1-[4-(dimethylamino)phenyl]pent-2-ene-1,4-dione (PubChem CID 13295314) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-acetyl-1-[4-(dimethylamino)phenyl]pent-2-ene-1,4-dione.
| Compound Name | 3-acetyl-1-[4-(dimethylamino)phenyl]pent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 13295314 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-acetyl-1-[4-(dimethylamino)phenyl]pent-2-ene-1,4-dione |
| SMILES | CC(=O)C(=CC(=O)c1ccc(N(C)C)cc1)C(C)=O |
| InChI | InChI=1S/C15H17NO3/c1-10(17)14(11(2)18)9-15(19)12-5-7-13(8-6-12)16(3)4/h5-9H,1-4H3 |
| InChIKey | UYVPWQHBNRRTCA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|