C33H39NO7 — CID 177399996
(E)-3-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(2-hydroxyethyl)amino]phenyl]-1,5-diphenylpent-2-ene-1,5-dione (PubChem CID 177399996) has the molecular formula C33H39NO7 and a molecular weight of 561.68 g/mol. Its IUPAC name is (E)-3-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(2-hydroxyethyl)amino]phenyl]-1,5-diphenylpent-2-ene-1,5-dione.
| Compound Name | (E)-3-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(2-hydroxyethyl)amino]phenyl]-1,5-diphenylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 177399996 |
| Molecular Formula | C33H39NO7 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | (E)-3-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(2-hydroxyethyl)amino]phenyl]-1,5-diphenylpent-2-ene-1,5-dione |
| SMILES | O=C(/C=C(\CC(=O)c1ccccc1)c1ccc(N(CCO)CCOCCOCCOCCO)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H39NO7/c35-17-15-34(16-19-39-21-23-41-24-22-40-20-18-36)31-13-11-27(12-14-31)30(25-32(37)28-7-3-1-4-8-28)26-33(38)29-9-5-2-6-10-29/h1-14,25,35-36H,15-24,26H2/b30-25+ |
| InChIKey | GSRCDIUVVAGICV-QCWLDUFUSA-N |
| XLogP | 4.07 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|