C56H107NO24 — CID 169196905
N,N-bis[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]aniline (PubChem CID 169196905) has the molecular formula C56H107NO24 and a molecular weight of 1178.45 g/mol. Its IUPAC name is N,N-bis[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]aniline.
| Compound Name | N,N-bis[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]aniline |
|---|---|
| PubChem CID | 169196905 |
| Molecular Formula | C56H107NO24 |
| Molecular Weight | 1178.45 g/mol |
| Exact Mass | 1177.72 |
| IUPAC Name | N,N-bis[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]aniline |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC)c1ccccc1 |
| InChI | InChI=1S/C56H107NO24/c1-58-12-14-62-20-22-66-28-30-70-36-38-74-44-46-78-52-54-80-50-48-76-42-40-72-34-32-68-26-24-64-18-16-60-10-8-57(56-6-4-3-5-7-56)9-11-61-17-19-65-25-27-69-33-35-73-41-43-77-49-51-81-55-53-79-47-45-75-39-37-71-31-29-67-23-21-63-15-13-59-2/h3-7H,8-55H2,1-2H3 |
| InChIKey | DOHKPVPMCQDRTJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 224.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 73 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1178.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|