C36H54N2O10 — CID 102029569
2,4-bis[4-[bis[2-(2-methoxyethoxy)ethyl]amino]phenyl]cyclobuta-1,3-diene-1,3-diol (PubChem CID 102029569) has the molecular formula C36H54N2O10 and a molecular weight of 674.83 g/mol. Its IUPAC name is 2,4-bis[4-[bis[2-(2-methoxyethoxy)ethyl]amino]phenyl]cyclobuta-1,3-diene-1,3-diol.
| Compound Name | 2,4-bis[4-[bis[2-(2-methoxyethoxy)ethyl]amino]phenyl]cyclobuta-1,3-diene-1,3-diol |
|---|---|
| PubChem CID | 102029569 |
| Molecular Formula | C36H54N2O10 |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.38 |
| IUPAC Name | 2,4-bis[4-[bis[2-(2-methoxyethoxy)ethyl]amino]phenyl]cyclobuta-1,3-diene-1,3-diol |
| SMILES | COCCOCCN(CCOCCOC)c1ccc(C2=C(O)C(c3ccc(N(CCOCCOC)CCOCCOC)cc3)=C2O)cc1 |
| InChI | InChI=1S/C36H54N2O10/c1-41-21-25-45-17-13-37(14-18-46-26-22-42-2)31-9-5-29(6-10-31)33-35(39)34(36(33)40)30-7-11-32(12-8-30)38(15-19-47-27-23-43-3)16-20-48-28-24-44-4/h5-12,39-40H,13-28H2,1-4H3 |
| InChIKey | AVIRJUNZGWFUNB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|