C29H38N2O10 — CID 102029187
4-[2-[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]ethynyl]pyridine-2,6-dicarboxylic acid (PubChem CID 102029187) has the molecular formula C29H38N2O10 and a molecular weight of 574.63 g/mol. Its IUPAC name is 4-[2-[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]ethynyl]pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[2-[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]ethynyl]pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 102029187 |
| Molecular Formula | C29H38N2O10 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 4-[2-[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]ethynyl]pyridine-2,6-dicarboxylic acid |
| SMILES | COCCOCCOCCN(CCOCCOCCOC)c1ccc(C#Cc2cc(C(=O)O)nc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C29H38N2O10/c1-36-13-15-40-19-17-38-11-9-31(10-12-39-18-20-41-16-14-37-2)25-7-5-23(6-8-25)3-4-24-21-26(28(32)33)30-27(22-24)29(34)35/h5-8,21-22H,9-20H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | WSVVPAQZXLSREE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 146.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|