C14H19NO2 — CID 102209421
4-ethynyl-N,N-bis(2-methoxyethyl)aniline (PubChem CID 102209421) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-ethynyl-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 4-ethynyl-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 102209421 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4-ethynyl-N,N-bis(2-methoxyethyl)aniline |
| SMILES | C#Cc1ccc(N(CCOC)CCOC)cc1 |
| InChI | InChI=1S/C14H19NO2/c1-4-13-5-7-14(8-6-13)15(9-11-16-2)10-12-17-3/h1,5-8H,9-12H2,2-3H3 |
| InChIKey | HUWWPJIGWCVPEI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|