C22H27N3 — CID 101460836
N,N-dibutyl-4-[(4-ethynylphenyl)diazenyl]aniline (PubChem CID 101460836) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is N,N-dibutyl-4-[(4-ethynylphenyl)diazenyl]aniline.
| Compound Name | N,N-dibutyl-4-[(4-ethynylphenyl)diazenyl]aniline |
|---|---|
| PubChem CID | 101460836 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N,N-dibutyl-4-[(4-ethynylphenyl)diazenyl]aniline |
| SMILES | C#Cc1ccc(/N=N/c2ccc(N(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C22H27N3/c1-4-7-17-25(18-8-5-2)22-15-13-21(14-16-22)24-23-20-11-9-19(6-3)10-12-20/h3,9-16H,4-5,7-8,17-18H2,1-2H3/b24-23+ |
| InChIKey | MICIBLLERPJURY-WCWDXBQESA-N |
| XLogP | 6.49 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|