C14H24NP — CID 175417850
N,N-dibutyl-4-phosphanylaniline (PubChem CID 175417850) has the molecular formula C14H24NP and a molecular weight of 237.33 g/mol. Its IUPAC name is N,N-dibutyl-4-phosphanylaniline.
| Compound Name | N,N-dibutyl-4-phosphanylaniline |
|---|---|
| PubChem CID | 175417850 |
| Molecular Formula | C14H24NP |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N,N-dibutyl-4-phosphanylaniline |
| SMILES | CCCCN(CCCC)c1ccc(P)cc1 |
| InChI | InChI=1S/C14H24NP/c1-3-5-11-15(12-6-4-2)13-7-9-14(16)10-8-13/h7-10H,3-6,11-12,16H2,1-2H3 |
| InChIKey | AHXBEOLTSYCMRL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|