C14H22FN — CID 15399711
N,N-dibutyl-4-fluoroaniline (PubChem CID 15399711) has the molecular formula C14H22FN and a molecular weight of 223.34 g/mol. Its IUPAC name is N,N-dibutyl-4-fluoroaniline.
| Compound Name | N,N-dibutyl-4-fluoroaniline |
|---|---|
| PubChem CID | 15399711 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N,N-dibutyl-4-fluoroaniline |
| SMILES | CCCCN(CCCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FN/c1-3-5-11-16(12-6-4-2)14-9-7-13(15)8-10-14/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | LPWBLAHVIWFXBH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |