C15H25FN2 — CID 43136281
N'-(4-fluorophenyl)-N'-hexylpropane-1,3-diamine (PubChem CID 43136281) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N'-hexylpropane-1,3-diamine.
| Compound Name | N'-(4-fluorophenyl)-N'-hexylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43136281 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N'-(4-fluorophenyl)-N'-hexylpropane-1,3-diamine |
| SMILES | CCCCCCN(CCCN)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H25FN2/c1-2-3-4-5-12-18(13-6-11-17)15-9-7-14(16)8-10-15/h7-10H,2-6,11-13,17H2,1H3 |
| InChIKey | MQNAHVJLKLQVOE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|