C22H38FN — CID 91747748
4-fluoro-N,N-dioctylaniline (PubChem CID 91747748) has the molecular formula C22H38FN and a molecular weight of 335.55 g/mol. Its IUPAC name is 4-fluoro-N,N-dioctylaniline.
| Compound Name | 4-fluoro-N,N-dioctylaniline |
|---|---|
| PubChem CID | 91747748 |
| Molecular Formula | C22H38FN |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.30 |
| IUPAC Name | 4-fluoro-N,N-dioctylaniline |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H38FN/c1-3-5-7-9-11-13-19-24(20-14-12-10-8-6-4-2)22-17-15-21(23)16-18-22/h15-18H,3-14,19-20H2,1-2H3 |
| InChIKey | LFDBRBVDBWHNFW-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|