About N-heptyl-N-pentylaniline
N-heptyl-N-pentylaniline (PubChem CID 154378615) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is N-heptyl-N-pentylaniline.
Molecular Properties
| Compound Name | N-heptyl-N-pentylaniline |
| PubChem CID | 154378615 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | N-heptyl-N-pentylaniline |
| SMILES | CCCCCCCN(CCCCC)c1ccccc1 |
| InChI | InChI=1S/C18H31N/c1-3-5-7-8-13-17-19(16-12-6-4-2)18-14-10-9-11-15-18/h9-11,14-15H,3-8,12-13,16-17H2,1-2H3 |
| InChIKey | RPJDKOHJHFHRAC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-heptyl-N-pentylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptyl-N-pentylaniline?
The IUPAC name of N-heptyl-N-pentylaniline (CID 154378615) is N-heptyl-N-pentylaniline.
What is the SMILES notation for N-heptyl-N-pentylaniline?
The canonical SMILES for N-heptyl-N-pentylaniline is CCCCCCCN(CCCCC)c1ccccc1.
What is the InChIKey of N-heptyl-N-pentylaniline?
The InChIKey is RPJDKOHJHFHRAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N/c1-3-5-7-8-13-17-19(16-12-6-4-2)18-14-10-9-11-15-18/h9-11,14-15H,3-8,12-13,16-17H2,1-2H3.
What are the key properties of N-heptyl-N-pentylaniline?
N-heptyl-N-pentylaniline has a molecular weight of 261.45 g/mol, XLogP of 5.65, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptyl-N-pentylaniline is sourced from PubChem (CID 154378615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).