About butane;N-octyl-N-phenylaniline
butane;N-octyl-N-phenylaniline (PubChem CID 175431375) has the molecular formula C24H37N
and a molecular weight of 339.57 g/mol. Its IUPAC name is butane;N-octyl-N-phenylaniline.
Molecular Properties
| Compound Name | butane;N-octyl-N-phenylaniline |
| PubChem CID | 175431375 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | butane;N-octyl-N-phenylaniline |
| SMILES | CCCC.CCCCCCCCN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27N.C4H10/c1-2-3-4-5-6-13-18-21(19-14-9-7-10-15-19)20-16-11-8-12-17-20;1-3-4-2/h7-12,14-17H,2-6,13,18H2,1H3;3-4H2,1-2H3 |
| InChIKey | JZANEHHFHMJIBM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;N-octyl-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N-octyl-N-phenylaniline?
The IUPAC name of butane;N-octyl-N-phenylaniline (CID 175431375) is butane;N-octyl-N-phenylaniline.
What is the SMILES notation for butane;N-octyl-N-phenylaniline?
The canonical SMILES for butane;N-octyl-N-phenylaniline is CCCC.CCCCCCCCN(c1ccccc1)c1ccccc1.
What is the InChIKey of butane;N-octyl-N-phenylaniline?
The InChIKey is JZANEHHFHMJIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N.C4H10/c1-2-3-4-5-6-13-18-21(19-14-9-7-10-15-19)20-16-11-8-12-17-20;1-3-4-2/h7-12,14-17H,2-6,13,18H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;N-octyl-N-phenylaniline?
butane;N-octyl-N-phenylaniline has a molecular weight of 339.57 g/mol, XLogP of 7.99, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N-octyl-N-phenylaniline is sourced from PubChem (CID 175431375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).