About N-butyl-N-phenylaniline;hydrobromide
N-butyl-N-phenylaniline;hydrobromide (PubChem CID 70419495) has the molecular formula C16H20BrN
and a molecular weight of 306.25 g/mol. Its IUPAC name is N-butyl-N-phenylaniline;hydrobromide.
Molecular Properties
| Compound Name | N-butyl-N-phenylaniline;hydrobromide |
| PubChem CID | 70419495 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-butyl-N-phenylaniline;hydrobromide |
| SMILES | Br.CCCCN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N.BrH/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;/h4-13H,2-3,14H2,1H3;1H |
| InChIKey | DLMLGOZKKVGTEP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butyl-N-phenylaniline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-phenylaniline;hydrobromide?
The IUPAC name of N-butyl-N-phenylaniline;hydrobromide (CID 70419495) is N-butyl-N-phenylaniline;hydrobromide.
What is the SMILES notation for N-butyl-N-phenylaniline;hydrobromide?
The canonical SMILES for N-butyl-N-phenylaniline;hydrobromide is Br.CCCCN(c1ccccc1)c1ccccc1.
What is the InChIKey of N-butyl-N-phenylaniline;hydrobromide?
The InChIKey is DLMLGOZKKVGTEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N.BrH/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;/h4-13H,2-3,14H2,1H3;1H.
What are the key properties of N-butyl-N-phenylaniline;hydrobromide?
N-butyl-N-phenylaniline;hydrobromide has a molecular weight of 306.25 g/mol, XLogP of 5.20, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-phenylaniline;hydrobromide is sourced from PubChem (CID 70419495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).