About naphthalen-1-amine;N-nonyl-N-phenylaniline
naphthalen-1-amine;N-nonyl-N-phenylaniline (PubChem CID 174946941) has the molecular formula C31H38N2
and a molecular weight of 438.66 g/mol. Its IUPAC name is naphthalen-1-amine;N-nonyl-N-phenylaniline.
Molecular Properties
| Compound Name | naphthalen-1-amine;N-nonyl-N-phenylaniline |
| PubChem CID | 174946941 |
| Molecular Formula | C31H38N2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | naphthalen-1-amine;N-nonyl-N-phenylaniline |
| SMILES | CCCCCCCCCN(c1ccccc1)c1ccccc1.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H29N.C10H9N/c1-2-3-4-5-6-7-14-19-22(20-15-10-8-11-16-20)21-17-12-9-13-18-21;11-10-7-3-5-8-4-1-2-6-9(8)10/h8-13,15-18H,2-7,14,19H2,1H3;1-7H,11H2 |
| InChIKey | HWJSIJKCGLLRGY-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-amine;N-nonyl-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-amine;N-nonyl-N-phenylaniline?
The IUPAC name of naphthalen-1-amine;N-nonyl-N-phenylaniline (CID 174946941) is naphthalen-1-amine;N-nonyl-N-phenylaniline.
What is the SMILES notation for naphthalen-1-amine;N-nonyl-N-phenylaniline?
The canonical SMILES for naphthalen-1-amine;N-nonyl-N-phenylaniline is CCCCCCCCCN(c1ccccc1)c1ccccc1.Nc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-amine;N-nonyl-N-phenylaniline?
The InChIKey is HWJSIJKCGLLRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N.C10H9N/c1-2-3-4-5-6-7-14-19-22(20-15-10-8-11-16-20)21-17-12-9-13-18-21;11-10-7-3-5-8-4-1-2-6-9(8)10/h8-13,15-18H,2-7,14,19H2,1H3;1-7H,11H2.
What are the key properties of naphthalen-1-amine;N-nonyl-N-phenylaniline?
naphthalen-1-amine;N-nonyl-N-phenylaniline has a molecular weight of 438.66 g/mol, XLogP of 9.00, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-amine;N-nonyl-N-phenylaniline is sourced from PubChem (CID 174946941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).