C14H24ClNO4 — CID 71443116
N,N-dibutylaniline;perchloric acid (PubChem CID 71443116) has the molecular formula C14H24ClNO4 and a molecular weight of 305.80 g/mol. Its IUPAC name is N,N-dibutylaniline;perchloric acid.
| Compound Name | N,N-dibutylaniline;perchloric acid |
|---|---|
| PubChem CID | 71443116 |
| Molecular Formula | C14H24ClNO4 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N,N-dibutylaniline;perchloric acid |
| SMILES | CCCCN(CCCC)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C14H23N.ClHO4/c1-3-5-12-15(13-6-4-2)14-10-8-7-9-11-14;2-1(3,4)5/h7-11H,3-6,12-13H2,1-2H3;(H,2,3,4,5) |
| InChIKey | SWECVVKERGXJMD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |