C23H45N — CID 142114632
N,N-dibutylaniline;propane;prop-1-ene (PubChem CID 142114632) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is N,N-dibutylaniline;propane;prop-1-ene.
| Compound Name | N,N-dibutylaniline;propane;prop-1-ene |
|---|---|
| PubChem CID | 142114632 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | N,N-dibutylaniline;propane;prop-1-ene |
| SMILES | C=CC.CCC.CCC.CCCCN(CCCC)c1ccccc1 |
| InChI | InChI=1S/C14H23N.2C3H8.C3H6/c1-3-5-12-15(13-6-4-2)14-10-8-7-9-11-14;3*1-3-2/h7-11H,3-6,12-13H2,1-2H3;2*3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | WRBFLCHGCZZCEX-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|