C20H27NO — CID 70287986
N,N-dibutyl-4-phenoxyaniline (PubChem CID 70287986) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N,N-dibutyl-4-phenoxyaniline.
| Compound Name | N,N-dibutyl-4-phenoxyaniline |
|---|---|
| PubChem CID | 70287986 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N,N-dibutyl-4-phenoxyaniline |
| SMILES | CCCCN(CCCC)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H27NO/c1-3-5-16-21(17-6-4-2)18-12-14-20(15-13-18)22-19-10-8-7-9-11-19/h7-15H,3-6,16-17H2,1-2H3 |
| InChIKey | INYSKIGHIWAFLU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |