About 4-(N-butylanilino)butyl phenyl carbonate
4-(N-butylanilino)butyl phenyl carbonate (PubChem CID 21419980) has the molecular formula C21H27NO3
and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-(N-butylanilino)butyl phenyl carbonate.
Molecular Properties
| Compound Name | 4-(N-butylanilino)butyl phenyl carbonate |
| PubChem CID | 21419980 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-(N-butylanilino)butyl phenyl carbonate |
| SMILES | CCCCN(CCCCOC(=O)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c1-2-3-16-22(19-12-6-4-7-13-19)17-10-11-18-24-21(23)25-20-14-8-5-9-15-20/h4-9,12-15H,2-3,10-11,16-18H2,1H3 |
| InChIKey | LYWLYFXCRWJHNA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 4-(N-butylanilino)butyl phenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N-butylanilino)butyl phenyl carbonate?
The IUPAC name of 4-(N-butylanilino)butyl phenyl carbonate (CID 21419980) is 4-(N-butylanilino)butyl phenyl carbonate.
What is the SMILES notation for 4-(N-butylanilino)butyl phenyl carbonate?
The canonical SMILES for 4-(N-butylanilino)butyl phenyl carbonate is CCCCN(CCCCOC(=O)Oc1ccccc1)c1ccccc1.
What is the InChIKey of 4-(N-butylanilino)butyl phenyl carbonate?
The InChIKey is LYWLYFXCRWJHNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO3/c1-2-3-16-22(19-12-6-4-7-13-19)17-10-11-18-24-21(23)25-20-14-8-5-9-15-20/h4-9,12-15H,2-3,10-11,16-18H2,1H3.
What are the key properties of 4-(N-butylanilino)butyl phenyl carbonate?
4-(N-butylanilino)butyl phenyl carbonate has a molecular weight of 341.45 g/mol, XLogP of 5.29, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N-butylanilino)butyl phenyl carbonate is sourced from PubChem (CID 21419980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).