C18H29NO5 — CID 160531229
2-(carboxymethoxy)acetic acid;N,N-dibutylaniline (PubChem CID 160531229) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-(carboxymethoxy)acetic acid;N,N-dibutylaniline.
| Compound Name | 2-(carboxymethoxy)acetic acid;N,N-dibutylaniline |
|---|---|
| PubChem CID | 160531229 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-(carboxymethoxy)acetic acid;N,N-dibutylaniline |
| SMILES | CCCCN(CCCC)c1ccccc1.O=C(O)COCC(=O)O |
| InChI | InChI=1S/C14H23N.C4H6O5/c1-3-5-12-15(13-6-4-2)14-10-8-7-9-11-14;5-3(6)1-9-2-4(7)8/h7-11H,3-6,12-13H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | QVOIXRFRNUWDRW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |