C16H31N — CID 142135231
N,N-dipropylaniline;ethane (PubChem CID 142135231) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is N,N-dipropylaniline;ethane.
| Compound Name | N,N-dipropylaniline;ethane |
|---|---|
| PubChem CID | 142135231 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N,N-dipropylaniline;ethane |
| SMILES | CC.CC.CCCN(CCC)c1ccccc1 |
| InChI | InChI=1S/C12H19N.2C2H6/c1-3-10-13(11-4-2)12-8-6-5-7-9-12;2*1-2/h5-9H,3-4,10-11H2,1-2H3;2*1-2H3 |
| InChIKey | AFYCXJQZURGKKQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |